CAS 176036-42-3 is the registry number for Captopril Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.
Propan-2-yl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate (CAS 176036-42-3) is a chemical compound with the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. IUPAC name: propan-2-yl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate. InChIKey: KMIOVNOWZMWMBH-ZJUUUORDSA-N.
| Molecular formula | C12H21NO3S |
|---|---|
| Molecular weight | 259.37 g/mol |
| IUPAC name | propan-2-yl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate |
| InChIKey | KMIOVNOWZMWMBH-ZJUUUORDSA-N |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)OC(C)C |
Computed by PubChem (NCBI)