Products 17616-76-1
CAS 17616-76-1 is the registry number for Cycloheptanone-2,2,7,7-d4. Offered by: TRC. Available pack sizes: 100mg.
2,2,7,7-tetradeuteriocycloheptan-1-one (CAS 17616-76-1) is a chemical compound with the molecular formula C7H12O and a molecular weight of 116.19 g/mol. IUPAC name: 2,2,7,7-tetradeuteriocycloheptan-1-one. InChIKey: CGZZMOTZOONQIA-NZLXMSDQSA-N.
| Molecular formula | C7H12O |
|---|---|
| Molecular weight | 116.19 g/mol |
| IUPAC name | 2,2,7,7-tetradeuteriocycloheptan-1-one |
| InChIKey | CGZZMOTZOONQIA-NZLXMSDQSA-N |
| SMILES | [2H]C1(CCCCC(C1=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)