CAS 176258-89-2 appears in our catalog under these names: Levothyroxine Impurity 12, 4-(4-Ethyl-2,6-diiodophenoxy)-2,6-diiodo-phenol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
4-(4-ethyl-2,6-diiodophenoxy)-2,6-diiodophenol (CAS 176258-89-2) is a chemical compound with the molecular formula C14H10I4O2 and a molecular weight of 717.84 g/mol. IUPAC name: 4-(4-ethyl-2,6-diiodophenoxy)-2,6-diiodophenol. InChIKey: RKEHIHICACCDQO-UHFFFAOYSA-N.
| Molecular formula | C14H10I4O2 |
|---|---|
| Molecular weight | 717.84 g/mol |
| IUPAC name | 4-(4-ethyl-2,6-diiodophenoxy)-2,6-diiodophenol |
| InChIKey | RKEHIHICACCDQO-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)I)OC2=CC(=C(C(=C2)I)O)I)I |
Computed by PubChem (NCBI)