CAS 1763-28-6 appears in our catalog under these names: 4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid, 95%, 4,4,4-Trifluoro-3-(trifluoromethyl)but-2-enoic acid 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4,4,4-trifluoro-3-(trifluoromethyl)but-2-enoic acid (CAS 1763-28-6) is a chemical compound with the molecular formula C5H2F6O2 and a molecular weight of 208.06 g/mol. IUPAC name: 4,4,4-trifluoro-3-(trifluoromethyl)but-2-enoic acid. InChIKey: ZSBJCNVMTCMOBW-UHFFFAOYSA-N.
| Molecular formula | C5H2F6O2 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-(trifluoromethyl)but-2-enoic acid |
| InChIKey | ZSBJCNVMTCMOBW-UHFFFAOYSA-N |
| SMILES | C(=C(C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)