CAS 17632-18-7 appears in our catalog under these names: 2,3,7,8,12,13,17,18-Octaethyl-21h,23h-porphine zinc(ii), 95%, 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PO, ZN(II) Octaethylporphine. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Zinc 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide (CAS 17632-18-7) is a chemical compound with the molecular formula C36H44N4Zn and a molecular weight of 598.1 g/mol. IUPAC name: zinc 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide. InChIKey: VVUVWOLOUOYXOI-UHFFFAOYSA-N.
| Molecular formula | C36H44N4Zn |
|---|---|
| Molecular weight | 598.1 g/mol |
| IUPAC name | zinc 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide |
| InChIKey | VVUVWOLOUOYXOI-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)CC)CC)CC)CC)C(=C3CC)CC)CC.[Zn+2] |
Computed by PubChem (NCBI)