CAS 17635-24-4 is the registry number for 6-Fluoro-2,3-dimethylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
6-fluoro-2,3-dimethylquinoxaline (CAS 17635-24-4) is a chemical compound with the molecular formula C10H9FN2 and a molecular weight of 176.19 g/mol. IUPAC name: 6-fluoro-2,3-dimethylquinoxaline. InChIKey: OCEWKKNSJQLOQZ-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2 |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | 6-fluoro-2,3-dimethylquinoxaline |
| InChIKey | OCEWKKNSJQLOQZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C=C(C=CC2=N1)F)C |
Computed by PubChem (NCBI)