Products 17635-24-4

CAS 17635-24-4 is the registry number for 6-Fluoro-2,3-dimethylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

6-fluoro-2,3-dimethylquinoxaline (CAS 17635-24-4) is a chemical compound with the molecular formula C10H9FN2 and a molecular weight of 176.19 g/mol. IUPAC name: 6-fluoro-2,3-dimethylquinoxaline. InChIKey: OCEWKKNSJQLOQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9FN2
Molecular weight176.19 g/mol
IUPAC name6-fluoro-2,3-dimethylquinoxaline
InChIKeyOCEWKKNSJQLOQZ-UHFFFAOYSA-N
SMILESCC1=C(N=C2C=C(C=CC2=N1)F)C

Computed by PubChem (NCBI)