CAS 176433-56-0 appears in our catalog under these names: 2,4-Dichloro-5-formyl-nicotinonitrile, 95%, 2,4-Dichloro-5-formylnicotinonitrile, 98%, 2,4-Dichloro-5-formylpyridine-3-carbonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
2,4-dichloro-5-formylpyridine-3-carbonitrile (CAS 176433-56-0) is a chemical compound with the molecular formula C7H2Cl2N2O and a molecular weight of 201.01 g/mol. IUPAC name: 2,4-dichloro-5-formylpyridine-3-carbonitrile. InChIKey: HWUQKELWCYCAFU-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2N2O |
|---|---|
| Molecular weight | 201.01 g/mol |
| IUPAC name | 2,4-dichloro-5-formylpyridine-3-carbonitrile |
| InChIKey | HWUQKELWCYCAFU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)C#N)Cl)C=O |
Computed by PubChem (NCBI)