CAS 176504-90-8 appears in our catalog under these names: Dimethyl ((3s)-4-phenyl-3-(boc-amino)-2-oxobutyl)phosphonate, 95%, Dimethyl((3S)–4–phenyl–3–(Boc–amino)–2–oxobutyl)phosphonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl N-[(2S)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]carbamate (CAS 176504-90-8) is a chemical compound with the molecular formula C17H26NO6P and a molecular weight of 371.4 g/mol. IUPAC name: tert-butyl N-[(2S)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]carbamate. InChIKey: YJHUSWVPKPKDHE-AWEZNQCLSA-N.
| Molecular formula | C17H26NO6P |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]carbamate |
| InChIKey | YJHUSWVPKPKDHE-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)CP(=O)(OC)OC |
Computed by PubChem (NCBI)