CAS 176520-23-3 appears in our catalog under these names: 2-(2-Azidoethoxy)ethyl methanesulfonate, 95%, Azide–PEG2–Ms, 2-(2-Azidoethoxy)ethyl methanesulfonate, 98%, 98%, Azide-PEG2-MS, 97.0%, Azide-PEG2-MS, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500 mg, 100 mg, 250 mg, 50 mg.
2-(2-azidoethoxy)ethyl methanesulfonate (CAS 176520-23-3) is a chemical compound with the molecular formula C5H11N3O4S and a molecular weight of 209.23 g/mol. IUPAC name: 2-(2-azidoethoxy)ethyl methanesulfonate. InChIKey: WDDYPDGUFZTNJJ-UHFFFAOYSA-N.
| Molecular formula | C5H11N3O4S |
|---|---|
| Molecular weight | 209.23 g/mol |
| IUPAC name | 2-(2-azidoethoxy)ethyl methanesulfonate |
| InChIKey | WDDYPDGUFZTNJJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)