Products 176528-19-1
CAS 176528-19-1 appears in our catalog under these names: (2,6-Dimethoxy-4-methylphenyl)boronic acid, 95%, (2,6-Dimethoxy-4-methylphenyl)boronic acid 95+%, (2,6-Dimethoxy-4-methylphenyl)boronic acid, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(2,6-dimethoxy-4-methylphenyl)boronic acid (CAS 176528-19-1) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: (2,6-dimethoxy-4-methylphenyl)boronic acid. InChIKey: KYPCCSCZXRYUAE-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | (2,6-dimethoxy-4-methylphenyl)boronic acid |
| InChIKey | KYPCCSCZXRYUAE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)C)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,6-Dimethoxy-4-methylphenyl)boronic acid, 2,6-dimethoxy-4-methylphenylboronic acid, (2,6-dimethoxy-4-methylphenyl)boronic acid(SALTDATA: FREE), (2,6-Dimethoxy-4-methylphenyl)boronicacid, KYPCCSCZXRYUAE-UHFFFAOYSA-N, (2,6-dimethoxy-4-methyl-phenyl)boronic acid, Boronic acid, B-(2,6-dimethoxy-4-methylphenyl)-, (2,6-Dimethoxy-4-methylphenyl)boronic acid, AldrichCPR