CAS 17654-88-5 is the registry number for Potassium 4-phenyl-5-thioxo-4,5-dihydro-1,3,4-thiadiazole-2-thiolate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-phenyl-1,3,4-thiadiazolidine-2,5-dithione (CAS 17654-88-5) is a chemical compound with the molecular formula C8H6N2S3 and a molecular weight of 226.3 g/mol. IUPAC name: 3-phenyl-1,3,4-thiadiazolidine-2,5-dithione. InChIKey: JRFUIXXCQSIOEB-UHFFFAOYSA-N.
| Molecular formula | C8H6N2S3 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 3-phenyl-1,3,4-thiadiazolidine-2,5-dithione |
| InChIKey | JRFUIXXCQSIOEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=S)SC(=S)N2 |
Computed by PubChem (NCBI)