Products 17659-59-5

CAS 17659-59-5 is the registry number for 1,5-Anhydro-D-glucitol 6-dihydrogenphosphate disodium. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate (CAS 17659-59-5) is a chemical compound with the molecular formula C6H13O8P and a molecular weight of 244.14 g/mol. IUPAC name: [(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate. InChIKey: KAJAXXUCVJFKFM-SLPGGIOYSA-N.

Identity
Molecular formulaC6H13O8P
Molecular weight244.14 g/mol
IUPAC name[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate
InChIKeyKAJAXXUCVJFKFM-SLPGGIOYSA-N
SMILESC1[C@@H]([C@H]([C@@H]([C@H](O1)COP(=O)(O)O)O)O)O

Computed by PubChem (NCBI)