CAS 17659-78-8 is the registry number for N-(3-Methylbutyl)adenosine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, Get quote.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbutylamino)purin-9-yl]oxolane-3,4-diol (CAS 17659-78-8) is a chemical compound with the molecular formula C15H23N5O4 and a molecular weight of 337.37 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbutylamino)purin-9-yl]oxolane-3,4-diol. InChIKey: AYGMJXUCSYBOMJ-SDBHATRESA-N.
| Molecular formula | C15H23N5O4 |
|---|---|
| Molecular weight | 337.37 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbutylamino)purin-9-yl]oxolane-3,4-diol |
| InChIKey | AYGMJXUCSYBOMJ-SDBHATRESA-N |
| SMILES | CC(C)CCNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)