CAS 17672-53-6 appears in our catalog under these names: Bis(2,2,2-Trichloroethyl) Phosphorochloridate, BIS-(2,2,2-TRICHLOROETHYL) PHOSPHORO-. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 1g, 2,5g, 5g, 10G, 50G.
1,1,1-trichloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxyethane (CAS 17672-53-6) is a chemical compound with the molecular formula C4H4Cl7O3P and a molecular weight of 379.2 g/mol. IUPAC name: 1,1,1-trichloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxyethane. InChIKey: ZHHCWQGVXYGWCW-UHFFFAOYSA-N.
| Molecular formula | C4H4Cl7O3P |
|---|---|
| Molecular weight | 379.2 g/mol |
| IUPAC name | 1,1,1-trichloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxyethane |
| InChIKey | ZHHCWQGVXYGWCW-UHFFFAOYSA-N |
| SMILES | C(C(Cl)(Cl)Cl)OP(=O)(OCC(Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)