Products 176721-04-3
CAS 176721-04-3 appears in our catalog under these names: 4-(1-(2,3-Dimethylphenyl)ethyl)-1H-imidazole L-Tartaric Acid, Dexmedetomidine-d4 L-Tartrate. Offered by: TRC, Chemat Brand. Available pack sizes: 25mg, on request.
(2R,3R)-2,3-dihydroxybutanedioic acid;5-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole (CAS 176721-04-3) is a chemical compound with the molecular formula C17H22N2O6 and a molecular weight of 350.4 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;5-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole. InChIKey: ITWNPJSUZOQVNY-MBANBULQSA-N.
| Molecular formula | C17H22N2O6 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;5-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole |
| InChIKey | ITWNPJSUZOQVNY-MBANBULQSA-N |
| SMILES | CC1=C(C(=CC=C1)[C@H](C)C2=CN=CN2)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)