CAS 176737-07-8 is the registry number for 2,3,4,9-Tetrahydro-1-(trichloromethyl)-1H-pyrido(3,4-b)indole Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
1-(trichloromethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (CAS 176737-07-8) is a chemical compound with the molecular formula C12H12Cl4N2 and a molecular weight of 326.0 g/mol. IUPAC name: 1-(trichloromethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride. InChIKey: LSXFSRFXSKXPMD-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl4N2 |
|---|---|
| Molecular weight | 326.0 g/mol |
| IUPAC name | 1-(trichloromethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| InChIKey | LSXFSRFXSKXPMD-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C3=CC=CC=C3N2)C(Cl)(Cl)Cl.Cl |
Computed by PubChem (NCBI)