CAS 17676-19-6 is the registry number for Methyl 2,6-Dideoxy-alpha-D-ribo-hexopyranoside. Offered by: TRC, Biosynth. Available pack sizes: 1g, 500mg, 1000mg.
(2R,3S,4S,6S)-6-methoxy-2-methyloxane-3,4-diol (CAS 17676-19-6) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: (2R,3S,4S,6S)-6-methoxy-2-methyloxane-3,4-diol. InChIKey: QNKOVWCOVLYPKR-JRTVQGFMSA-N.
| Molecular formula | C7H14O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | (2R,3S,4S,6S)-6-methoxy-2-methyloxane-3,4-diol |
| InChIKey | QNKOVWCOVLYPKR-JRTVQGFMSA-N |
| SMILES | C[C@@H]1[C@H]([C@H](C[C@H](O1)OC)O)O |
Computed by PubChem (NCBI)