CAS 176762-26-8 is the registry number for 2-Hydrazino-4,6-bis(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4,6-bis(trifluoromethyl)-2-pyridinyl]hydrazine (CAS 176762-26-8) is a chemical compound with the molecular formula C7H5F6N3 and a molecular weight of 245.13 g/mol. IUPAC name: [4,6-bis(trifluoromethyl)-2-pyridinyl]hydrazine. InChIKey: PKHIMVUFGUKWHZ-UHFFFAOYSA-N.
| Molecular formula | C7H5F6N3 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | [4,6-bis(trifluoromethyl)-2-pyridinyl]hydrazine |
| InChIKey | PKHIMVUFGUKWHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)NN)C(F)(F)F |
Computed by PubChem (NCBI)