CAS 1768-31-6 appears in our catalog under these names: 1,1,1,3,3-pentachloropropan-2-one, Pentachloroacetone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
1,1,1,3,3-pentachloropropan-2-one (CAS 1768-31-6) is a chemical compound with the molecular formula C3HCl5O and a molecular weight of 230.3 g/mol. IUPAC name: 1,1,1,3,3-pentachloropropan-2-one. InChIKey: RVSIFWBAGVMQKT-UHFFFAOYSA-N.
| Molecular formula | C3HCl5O |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 1,1,1,3,3-pentachloropropan-2-one |
| InChIKey | RVSIFWBAGVMQKT-UHFFFAOYSA-N |
| SMILES | C(C(=O)C(Cl)(Cl)Cl)(Cl)Cl |
Computed by PubChem (NCBI)