CAS 17689-66-6 appears in our catalog under these names: 3-Hydroxy-3-methylbutyl 4-methylbenzenesulfonate, 96%, 3–hydroxy–3–methylbutyl 4–methylbenzenesulfonate, 3-hydroxy-3-methylbutyl 4-methylbenzenesulfonate, 3-Hydroxy-3-methylbutyl 4-methylbenzenesulfonate 95%, 3-hydroxy-3-methylbutyl 4-methylbenzenesulfonate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 0,5g, 250mg.
(3-hydroxy-3-methylbutyl) 4-methylbenzenesulfonate (CAS 17689-66-6) is a chemical compound with the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. IUPAC name: (3-hydroxy-3-methylbutyl) 4-methylbenzenesulfonate. InChIKey: GGLYIKZLOPXYOV-UHFFFAOYSA-N.
| Molecular formula | C12H18O4S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | (3-hydroxy-3-methylbutyl) 4-methylbenzenesulfonate |
| InChIKey | GGLYIKZLOPXYOV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC(C)(C)O |
Computed by PubChem (NCBI)