CAS 17689-77-9 appears in our catalog under these names: Ethyltriacetoxysilane, 96%, Triacetoxyethylsilane, 98+%, Ethylsilanetriyl triacetate, Triacetoxy(ethyl)silane, 96% , Triacetoxyethylsilane, >98.0%(qNMR). Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 100g, 500g, 1g, 5g.
[diacetyloxy(ethyl)silyl] acetate (CAS 17689-77-9) is a chemical compound with the molecular formula C8H14O6Si and a molecular weight of 234.28 g/mol. IUPAC name: [diacetyloxy(ethyl)silyl] acetate. InChIKey: KXJLGCBCRCSXQF-UHFFFAOYSA-N.
| Molecular formula | C8H14O6Si |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | [diacetyloxy(ethyl)silyl] acetate |
| InChIKey | KXJLGCBCRCSXQF-UHFFFAOYSA-N |
| SMILES | CC[Si](OC(=O)C)(OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)