CAS 17697-12-0 appears in our catalog under these names: Phenylseleninic Anhydride, Benzeneseleninic anhydride, Benzeneseleninic anhydride, 98%, Benzeneseleninic acid anhydride 98%, Phenylseleninic Anhydride, 95%, 95%. Offered by: TRC, Biosynth, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 100mg, 1g, 500mg, 25g, 50g, 5g, 100g, 250g.
Phenylseleninyl benzeneseleninate (CAS 17697-12-0) is a chemical compound with the molecular formula C12H10O3Se2 and a molecular weight of 360.1 g/mol. IUPAC name: phenylseleninyl benzeneseleninate. InChIKey: FHPZOWOEILXXBD-UHFFFAOYSA-N.
| Molecular formula | C12H10O3Se2 |
|---|---|
| Molecular weight | 360.1 g/mol |
| IUPAC name | phenylseleninyl benzeneseleninate |
| InChIKey | FHPZOWOEILXXBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se](=O)O[Se](=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)