CAS 176982-57-3 appears in our catalog under these names: (S)-3-Boc-aminobutylamine hydrochloride, 95%, tert-Butyl N-[(2S)-4-aminobutan-2-yl]carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(2S)-4-aminobutan-2-yl]carbamate (CAS 176982-57-3) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. IUPAC name: tert-butyl N-[(2S)-4-aminobutan-2-yl]carbamate. InChIKey: JOFFSNZHLGGAJC-ZETCQYMHSA-N.
| Molecular formula | C9H20N2O2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-aminobutan-2-yl]carbamate |
| InChIKey | JOFFSNZHLGGAJC-ZETCQYMHSA-N |
| SMILES | C[C@@H](CCN)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)