CAS 17699-16-0 is the registry number for trans-Sabinene hydrate. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,5S)-2-methyl-5-propan-2-ylbicyclo[3.1.0]hexan-2-ol (CAS 17699-16-0) is a chemical compound with the molecular formula C10H18O and a molecular weight of 154.25 g/mol. IUPAC name: (1R,2R,5S)-2-methyl-5-propan-2-ylbicyclo[3.1.0]hexan-2-ol. InChIKey: KXSDPILWMGFJMM-AEJSXWLSSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1R,2R,5S)-2-methyl-5-propan-2-ylbicyclo[3.1.0]hexan-2-ol |
| InChIKey | KXSDPILWMGFJMM-AEJSXWLSSA-N |
| SMILES | CC(C)[C@@]12CC[C@@]([C@@H]1C2)(C)O |
Computed by PubChem (NCBI)