CAS 1770-54-3 is the registry number for Perphenylcyclopentasilane. Offered by: TRC. Available pack sizes: 100mg, 2,5g, 500mg.
1,1,2,2,3,3,4,4,5,5-decakis-phenylpentasilolane (CAS 1770-54-3) is a chemical compound with the molecular formula C60H50Si5 and a molecular weight of 911.5 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5-decakis-phenylpentasilolane. InChIKey: APRDARTZFVUGQN-UHFFFAOYSA-N.
| Molecular formula | C60H50Si5 |
|---|---|
| Molecular weight | 911.5 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5-decakis-phenylpentasilolane |
| InChIKey | APRDARTZFVUGQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si]2([Si]([Si]([Si]([Si]2(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8)(C9=CC=CC=C9)C1=CC=CC=C1)C1=CC=CC=C1 |
Computed by PubChem (NCBI)