CAS 1770-80-5 is the registry number for Dibutyl chlorendate. Offered by: Chemat Brand. Available pack sizes: on request.
Dibutyl 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CAS 1770-80-5) is a chemical compound with the molecular formula C17H20Cl6O4 and a molecular weight of 501.0 g/mol. IUPAC name: dibutyl 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate. InChIKey: UJAHPBDUQZFDLA-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl6O4 |
|---|---|
| Molecular weight | 501.0 g/mol |
| IUPAC name | dibutyl 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| InChIKey | UJAHPBDUQZFDLA-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)OCCCC |
Computed by PubChem (NCBI)