Products 1770-80-5

CAS 1770-80-5 is the registry number for Dibutyl chlorendate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dibutyl 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CAS 1770-80-5) is a chemical compound with the molecular formula C17H20Cl6O4 and a molecular weight of 501.0 g/mol. IUPAC name: dibutyl 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate. InChIKey: UJAHPBDUQZFDLA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20Cl6O4
Molecular weight501.0 g/mol
IUPAC namedibutyl 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
InChIKeyUJAHPBDUQZFDLA-UHFFFAOYSA-N
SMILESCCCCOC(=O)C1C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)OCCCC

Computed by PubChem (NCBI)