Products 177024-62-3

CAS 177024-62-3 is the registry number for Creatine citrate, 97%. Offered by: Combi-blocks. Available pack sizes: 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 177024-62-3) is a chemical compound with the molecular formula C10H17N3O9 and a molecular weight of 323.26 g/mol. IUPAC name: 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: MBBREGJRSROLGD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17N3O9
Molecular weight323.26 g/mol
IUPAC name2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxypropane-1,2,3-tricarboxylic acid
InChIKeyMBBREGJRSROLGD-UHFFFAOYSA-N
SMILESCN(CC(=O)O)C(=N)N.C(C(=O)O)C(CC(=O)O)(C(=O)O)O

Computed by PubChem (NCBI)