CAS 17714-02-2 appears in our catalog under these names: Clonazepam Impurity 3, Clonazepam Impurity 6. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
2-amino-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide (CAS 17714-02-2) is a chemical compound with the molecular formula C15H12ClN3O4 and a molecular weight of 333.72 g/mol. IUPAC name: 2-amino-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide. InChIKey: VDWHFAAXPZFFEI-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O4 |
|---|---|
| Molecular weight | 333.72 g/mol |
| IUPAC name | 2-amino-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide |
| InChIKey | VDWHFAAXPZFFEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])NC(=O)CN)Cl |
Computed by PubChem (NCBI)