Products 1772-40-3

CAS 1772-40-3 is the registry number for 1H-Benzo[d]imidazol-6-amine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

3H-benzimidazol-5-amine;hydrochloride (CAS 1772-40-3) is a chemical compound with the molecular formula C7H8ClN3 and a molecular weight of 169.61 g/mol. IUPAC name: 3H-benzimidazol-5-amine;hydrochloride. InChIKey: JBBDFXOCBQKHMN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClN3
Molecular weight169.61 g/mol
IUPAC name3H-benzimidazol-5-amine;hydrochloride
InChIKeyJBBDFXOCBQKHMN-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1N)NC=N2.Cl

Computed by PubChem (NCBI)