CAS 177348-28-6 is the registry number for Di-tert-butyl Chloromethylphosphonate. Offered by: TRC. Available pack sizes: 100mg.
2-[chloromethyl-[(2-methylpropan-2-yl)oxy]phosphoryl]oxy-2-methylpropane (CAS 177348-28-6) is a chemical compound with the molecular formula C9H20ClO3P and a molecular weight of 242.68 g/mol. IUPAC name: 2-[chloromethyl-[(2-methylpropan-2-yl)oxy]phosphoryl]oxy-2-methylpropane. InChIKey: NPJMUNQBBLIMEM-UHFFFAOYSA-N.
| Molecular formula | C9H20ClO3P |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | 2-[chloromethyl-[(2-methylpropan-2-yl)oxy]phosphoryl]oxy-2-methylpropane |
| InChIKey | NPJMUNQBBLIMEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(CCl)OC(C)(C)C |
Computed by PubChem (NCBI)