CAS 1773493-87-0 appears in our catalog under these names: 1,4-dimethyl (2R,3R)-2,3-bis[(4-methylphenyl)carbonyloxy]butanedioate, 95%, (2R,3R)-Dimethyl 2,3-bis(tosyloxy)succinate, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
Dimethyl (2R,3R)-2,3-bis-(4-methylphenyl)sulfonyloxybutanedioate (CAS 1773493-87-0) is a chemical compound with the molecular formula C20H22O10S2 and a molecular weight of 486.5 g/mol. IUPAC name: dimethyl (2R,3R)-2,3-bis-(4-methylphenyl)sulfonyloxybutanedioate. InChIKey: RVDUUVRRIXEPGN-QZTJIDSGSA-N.
| Molecular formula | C20H22O10S2 |
|---|---|
| Molecular weight | 486.5 g/mol |
| IUPAC name | dimethyl (2R,3R)-2,3-bis-(4-methylphenyl)sulfonyloxybutanedioate |
| InChIKey | RVDUUVRRIXEPGN-QZTJIDSGSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@H]([C@H](C(=O)OC)OS(=O)(=O)C2=CC=C(C=C2)C)C(=O)OC |
Computed by PubChem (NCBI)