Products 177359-60-3

CAS 177359-60-3 appears in our catalog under these names: 5-Methylpicolinic acid hydrochloride, 95%, 5-Methylpicolinic acid hydrochloride, 98%, 5–Methylpicolinic acid hydrochloride, 5-Methylpyridine-2-carboxylic acid hydrochloride, 5-Methylpicolinic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 50g, 25g, 100g.

Structural formula: {0} (CAS {1})

5-methylpyridine-2-carboxylic acid;hydrochloride (CAS 177359-60-3) is a chemical compound with the molecular formula C7H8ClNO2 and a molecular weight of 173.60 g/mol. IUPAC name: 5-methylpyridine-2-carboxylic acid;hydrochloride. InChIKey: JNFOZAYGOQOYAB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClNO2
Molecular weight173.60 g/mol
IUPAC name5-methylpyridine-2-carboxylic acid;hydrochloride
InChIKeyJNFOZAYGOQOYAB-UHFFFAOYSA-N
SMILESCC1=CN=C(C=C1)C(=O)O.Cl

Computed by PubChem (NCBI)