CAS 177366-89-1 is the registry number for rac-cis-(3-Hydroxycyclohexyl)benzamide. Offered by: TRC. Available pack sizes: 100mg, 10mg.
N-[(1R,3S)-3-hydroxycyclohexyl]benzamide (CAS 177366-89-1) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: N-[(1R,3S)-3-hydroxycyclohexyl]benzamide. InChIKey: BYHCFBWCQDHOMN-NEPJUHHUSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | N-[(1R,3S)-3-hydroxycyclohexyl]benzamide |
| InChIKey | BYHCFBWCQDHOMN-NEPJUHHUSA-N |
| SMILES | C1C[C@H](C[C@H](C1)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)