CAS 177472-54-7 is the registry number for rac-tert-butyl N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]carbamate (CAS 177472-54-7) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]carbamate. InChIKey: OCKKMJSVLVALMF-NKWVEPMBSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]carbamate |
| InChIKey | OCKKMJSVLVALMF-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1CO |
Computed by PubChem (NCBI)