CAS 1774896-01-3 is the registry number for 1-Benzyl-4-(4-bromo-2-(trifluoromethyl)-phenyl)piperazine. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
1-benzyl-4-[4-bromo-2-(trifluoromethyl)phenyl]piperazine (CAS 1774896-01-3) is a chemical compound with the molecular formula C18H18BrF3N2 and a molecular weight of 399.2 g/mol. IUPAC name: 1-benzyl-4-[4-bromo-2-(trifluoromethyl)phenyl]piperazine. InChIKey: AKUHKHFFEWFBKQ-UHFFFAOYSA-N.
| Molecular formula | C18H18BrF3N2 |
|---|---|
| Molecular weight | 399.2 g/mol |
| IUPAC name | 1-benzyl-4-[4-bromo-2-(trifluoromethyl)phenyl]piperazine |
| InChIKey | AKUHKHFFEWFBKQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C3=C(C=C(C=C3)Br)C(F)(F)F |
Computed by PubChem (NCBI)