CAS 17749-99-4 is the registry number for 1,3,7,9-Xanthinium Perchlorate. Offered by: TRC. Available pack sizes: 750mg.
1,3,7,9-tetramethylpurin-9-ium-2,6-dione perchlorate (CAS 17749-99-4) is a chemical compound with the molecular formula C9H13ClN4O6 and a molecular weight of 308.67 g/mol. IUPAC name: 1,3,7,9-tetramethylpurin-9-ium-2,6-dione perchlorate. InChIKey: APBBIXSRRHCKCU-UHFFFAOYSA-M.
| Molecular formula | C9H13ClN4O6 |
|---|---|
| Molecular weight | 308.67 g/mol |
| IUPAC name | 1,3,7,9-tetramethylpurin-9-ium-2,6-dione perchlorate |
| InChIKey | APBBIXSRRHCKCU-UHFFFAOYSA-M |
| SMILES | CN1C=[N+](C2=C1C(=O)N(C(=O)N2C)C)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)