CAS 17754-01-7 is the registry number for 4,7-Dibromo-5,6-dichlorobenzo[c][1,2,5]thiadiazole, 97%. Offered by: Chemat Brand. Available pack sizes: 250mg, 1g.
4,7-dibromo-5,6-dichloro-2,1,3-benzothiadiazole (CAS 17754-01-7) is a chemical compound with the molecular formula C6Br2Cl2N2S and a molecular weight of 362.86 g/mol. IUPAC name: 4,7-dibromo-5,6-dichloro-2,1,3-benzothiadiazole. InChIKey: HIAJJWRLCFFJRQ-UHFFFAOYSA-N.
| Molecular formula | C6Br2Cl2N2S |
|---|---|
| Molecular weight | 362.86 g/mol |
| IUPAC name | 4,7-dibromo-5,6-dichloro-2,1,3-benzothiadiazole |
| InChIKey | HIAJJWRLCFFJRQ-UHFFFAOYSA-N |
| SMILES | C1(=C(C2=NSN=C2C(=C1Cl)Br)Br)Cl |
Computed by PubChem (NCBI)