CAS 1775892-27-7 is the registry number for 4-Fluoro-2-nitro-N-(2-phenoxyethyl)aniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-fluoro-2-nitro-N-(2-phenoxyethyl)aniline (CAS 1775892-27-7) is a chemical compound with the molecular formula C14H13FN2O3 and a molecular weight of 276.26 g/mol. IUPAC name: 4-fluoro-2-nitro-N-(2-phenoxyethyl)aniline. InChIKey: MBSFCMPYGFSQKT-UHFFFAOYSA-N.
| Molecular formula | C14H13FN2O3 |
|---|---|
| Molecular weight | 276.26 g/mol |
| IUPAC name | 4-fluoro-2-nitro-N-(2-phenoxyethyl)aniline |
| InChIKey | MBSFCMPYGFSQKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCNC2=C(C=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)