CAS 1777-45-3 appears in our catalog under these names: (1R,3R,5S)-bicyclo(3.1.0)hexane-3-carboxylic acid, 95%, Rel-(1R,3R,5S)-bicyclo(3.1.0)hexane-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1S,5R)-bicyclo[3.1.0]hexane-3-carboxylic acid (CAS 1777-45-3) is a chemical compound with the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. IUPAC name: (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylic acid. InChIKey: IEEUSWYDXDXBNK-XEAPYIEGSA-N.
| Molecular formula | C7H10O2 |
|---|---|
| Molecular weight | 126.15 g/mol |
| IUPAC name | (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylic acid |
| InChIKey | IEEUSWYDXDXBNK-XEAPYIEGSA-N |
| SMILES | C1[C@H]2[C@@H]1CC(C2)C(=O)O |
Computed by PubChem (NCBI)