CAS 17772-88-2 appears in our catalog under these names: N-Acetyl D-Alpha-Methyl DOPA Dimethyl Ether (+)-Alpha-Methylbenzylamine Salt, N-Acetyl D-alpha-methyl dopa dimethyl ether (+)-alpha-methylbenzylamine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg.
(2R)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;(1R)-1-phenylethanamine (CAS 17772-88-2) is a chemical compound with the molecular formula C22H30N2O5 and a molecular weight of 402.5 g/mol. IUPAC name: (2R)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;(1R)-1-phenylethanamine. InChIKey: KDQYJRLZCOLDFL-ASTHLYEOSA-N.
| Molecular formula | C22H30N2O5 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;(1R)-1-phenylethanamine |
| InChIKey | KDQYJRLZCOLDFL-ASTHLYEOSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N.CC(=O)N[C@](C)(CC1=CC(=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)