CAS 177733-57-2 is the registry number for 3',5'-Bis(trifluoromethyl)biphenyl-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[3,5-bis(trifluoromethyl)phenyl]benzoic acid (CAS 177733-57-2) is a chemical compound with the molecular formula C15H8F6O2 and a molecular weight of 334.21 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]benzoic acid. InChIKey: CQHZXIFZCHSGIU-UHFFFAOYSA-N.
| Molecular formula | C15H8F6O2 |
|---|---|
| Molecular weight | 334.21 g/mol |
| IUPAC name | 3-[3,5-bis(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | CQHZXIFZCHSGIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)