Products 177733-57-2

CAS 177733-57-2 is the registry number for 3',5'-Bis(trifluoromethyl)biphenyl-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[3,5-bis(trifluoromethyl)phenyl]benzoic acid (CAS 177733-57-2) is a chemical compound with the molecular formula C15H8F6O2 and a molecular weight of 334.21 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]benzoic acid. InChIKey: CQHZXIFZCHSGIU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H8F6O2
Molecular weight334.21 g/mol
IUPAC name3-[3,5-bis(trifluoromethyl)phenyl]benzoic acid
InChIKeyCQHZXIFZCHSGIU-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F

Computed by PubChem (NCBI)