CAS 177735-49-8 is the registry number for (2-Formylbenzo(b)thiophen-3-yl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(2-formyl-1-benzothiophen-3-yl)boronic acid (CAS 177735-49-8) is a chemical compound with the molecular formula C9H7BO3S and a molecular weight of 206.03 g/mol. IUPAC name: (2-formyl-1-benzothiophen-3-yl)boronic acid. InChIKey: OFOYQDKBNWEHEE-UHFFFAOYSA-N.
| Molecular formula | C9H7BO3S |
|---|---|
| Molecular weight | 206.03 g/mol |
| IUPAC name | (2-formyl-1-benzothiophen-3-yl)boronic acid |
| InChIKey | OFOYQDKBNWEHEE-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC2=CC=CC=C12)C=O)(O)O |
Computed by PubChem (NCBI)