CAS 177744-96-6 appears in our catalog under these names: Raloxifene Impurity D, LY 88074, >95% (HPLC), LY88074, 97%, LY88074/ 98.05% (existing batch purity), LY88074. Offered by: Chemat Brand, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 100mg, 50mg, 1mg, 5mg, 25mg, 250mg.
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-hydroxyphenyl)methanone (CAS 177744-96-6) is a chemical compound with the molecular formula C21H14O4S and a molecular weight of 362.4 g/mol. IUPAC name: [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-hydroxyphenyl)methanone. InChIKey: CTMKIRXPVZYQJP-UHFFFAOYSA-N.
| Molecular formula | C21H14O4S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-hydroxyphenyl)methanone |
| InChIKey | CTMKIRXPVZYQJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C3=C(S2)C=C(C=C3)O)C(=O)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)