CAS 17776-78-2 is the registry number for Bis(2-chlorophenyl) phosphorochloridate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
1-chloro-2-[chloro-(2-chlorophenoxy)phosphoryl]oxybenzene (CAS 17776-78-2) is a chemical compound with the molecular formula C12H8Cl3O3P and a molecular weight of 337.5 g/mol. IUPAC name: 1-chloro-2-[chloro-(2-chlorophenoxy)phosphoryl]oxybenzene. InChIKey: ZLSGEMKKBUVQOM-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl3O3P |
|---|---|
| Molecular weight | 337.5 g/mol |
| IUPAC name | 1-chloro-2-[chloro-(2-chlorophenoxy)phosphoryl]oxybenzene |
| InChIKey | ZLSGEMKKBUVQOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OP(=O)(OC2=CC=CC=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)