Products 177765-50-3
CAS 177765-50-3 is the registry number for trans-1,2-Diaminocycloheptane dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg.
Trans-(1R,2R)-cycloheptane-1,2-diamine;dihydrochloride (CAS 177765-50-3) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: trans-(1R,2R)-cycloheptane-1,2-diamine;dihydrochloride. InChIKey: UJOOFCPCSYHQAX-GPJOBVNKSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | trans-(1R,2R)-cycloheptane-1,2-diamine;dihydrochloride |
| InChIKey | UJOOFCPCSYHQAX-GPJOBVNKSA-N |
| SMILES | C1CC[C@H]([C@@H](CC1)N)N.Cl.Cl |
Computed by PubChem (NCBI)