CAS 177785-44-3 appears in our catalog under these names: 4-Chloro-2,3,6-trifluoroaniline, 95%, 4-Chloro-2,3,6-trifluoroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-chloro-2,3,6-trifluoroaniline (CAS 177785-44-3) is a chemical compound with the molecular formula C6H3ClF3N and a molecular weight of 181.54 g/mol. IUPAC name: 4-chloro-2,3,6-trifluoroaniline. InChIKey: QQLHZZUOMSMLQZ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3N |
|---|---|
| Molecular weight | 181.54 g/mol |
| IUPAC name | 4-chloro-2,3,6-trifluoroaniline |
| InChIKey | QQLHZZUOMSMLQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)F)N)F |
Computed by PubChem (NCBI)