CAS 177793-80-5 appears in our catalog under these names: Palonosetron Impurity 5, (3S)-N-(((1S)-1,2,3,4-Tetrahydro-1-naphthalenyl)methyl)-1-azabicyclo(2.2.2)octan-3-amine, Palonosetron Impurity 12, Palonosetron Impurity 33. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(3S)-N-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-1-azabicyclo[2.2.2]octan-3-amine (CAS 177793-80-5) is a chemical compound with the molecular formula C18H26N2 and a molecular weight of 270.4 g/mol. IUPAC name: (3S)-N-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-1-azabicyclo[2.2.2]octan-3-amine. InChIKey: BCXAOEQLKWKVHU-SJLPKXTDSA-N.
| Molecular formula | C18H26N2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (3S)-N-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| InChIKey | BCXAOEQLKWKVHU-SJLPKXTDSA-N |
| SMILES | C1C[C@@H](C2=CC=CC=C2C1)CN[C@@H]3CN4CCC3CC4 |
Computed by PubChem (NCBI)