CAS 177843-66-2 appears in our catalog under these names: 2-tert-Butyl-1h-benzimidazol-5-amine, 98%, 2-(tert-Butyl)-1H-benzo(d)imidazol-5-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-tert-butyl-3H-benzimidazol-5-amine (CAS 177843-66-2) is a chemical compound with the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. IUPAC name: 2-tert-butyl-3H-benzimidazol-5-amine. InChIKey: SLZVZHKZDFTTJL-UHFFFAOYSA-N.
| Molecular formula | C11H15N3 |
|---|---|
| Molecular weight | 189.26 g/mol |
| IUPAC name | 2-tert-butyl-3H-benzimidazol-5-amine |
| InChIKey | SLZVZHKZDFTTJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(N1)C=C(C=C2)N |
Computed by PubChem (NCBI)