CAS 1778487-87-8 is the registry number for 5-Bromo-2-(4-fluoro-phenylsulfanyl)-benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-(4-fluorophenyl)sulfanylbenzonitrile (CAS 1778487-87-8) is a chemical compound with the molecular formula C13H7BrFNS and a molecular weight of 308.17 g/mol. IUPAC name: 5-bromo-2-(4-fluorophenyl)sulfanylbenzonitrile. InChIKey: UIWXQTPUCHBSPE-UHFFFAOYSA-N.
| Molecular formula | C13H7BrFNS |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 5-bromo-2-(4-fluorophenyl)sulfanylbenzonitrile |
| InChIKey | UIWXQTPUCHBSPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)SC2=C(C=C(C=C2)Br)C#N |
Computed by PubChem (NCBI)