CAS 1778703-67-5 is the registry number for Polmacoxib Impurity 5 Sodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfinate (CAS 1778703-67-5) is a chemical compound with the molecular formula C18H14FNaO4S and a molecular weight of 368.4 g/mol. IUPAC name: sodium 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfinate. InChIKey: NANQELZRMZZGAN-UHFFFAOYSA-M.
| Molecular formula | C18H14FNaO4S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | sodium 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfinate |
| InChIKey | NANQELZRMZZGAN-UHFFFAOYSA-M |
| SMILES | CC1(C(=O)C(=C(O1)C2=CC=C(C=C2)S(=O)[O-])C3=CC(=CC=C3)F)C.[Na+] |
Computed by PubChem (NCBI)